About 3-[6-(dipropylcarbamoylamino)hexyl]-1,1-dipropylurea
3-[6-(dipropylcarbamoylamino)hexyl]-1,1-dipropylurea (PubChem CID 3141105) has the molecular formula C20H42N4O2
and a molecular weight of 370.58 g/mol. Its IUPAC name is 3-[6-(dipropylcarbamoylamino)hexyl]-1,1-dipropylurea.
Molecular Properties
| Compound Name | 3-[6-(dipropylcarbamoylamino)hexyl]-1,1-dipropylurea |
| PubChem CID | 3141105 |
| Molecular Formula | C20H42N4O2 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.33 |
| IUPAC Name | 3-[6-(dipropylcarbamoylamino)hexyl]-1,1-dipropylurea |
| SMILES | CCCN(CCC)C(=O)NCCCCCCNC(=O)N(CCC)CCC |
| InChI | InChI=1S/C20H42N4O2/c1-5-15-23(16-6-2)19(25)21-13-11-9-10-12-14-22-20(26)24(17-7-3)18-8-4/h5-18H2,1-4H3,(H,21,25)(H,22,26) |
| InChIKey | NLFNPYUYNBAFKK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[6-(dipropylcarbamoylamino)hexyl]-1,1-dipropylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-(dipropylcarbamoylamino)hexyl]-1,1-dipropylurea?
The IUPAC name of 3-[6-(dipropylcarbamoylamino)hexyl]-1,1-dipropylurea (CID 3141105) is 3-[6-(dipropylcarbamoylamino)hexyl]-1,1-dipropylurea.
What is the SMILES notation for 3-[6-(dipropylcarbamoylamino)hexyl]-1,1-dipropylurea?
The canonical SMILES for 3-[6-(dipropylcarbamoylamino)hexyl]-1,1-dipropylurea is CCCN(CCC)C(=O)NCCCCCCNC(=O)N(CCC)CCC.
What is the InChIKey of 3-[6-(dipropylcarbamoylamino)hexyl]-1,1-dipropylurea?
The InChIKey is NLFNPYUYNBAFKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H42N4O2/c1-5-15-23(16-6-2)19(25)21-13-11-9-10-12-14-22-20(26)24(17-7-3)18-8-4/h5-18H2,1-4H3,(H,21,25)(H,22,26).
What are the key properties of 3-[6-(dipropylcarbamoylamino)hexyl]-1,1-dipropylurea?
3-[6-(dipropylcarbamoylamino)hexyl]-1,1-dipropylurea has a molecular weight of 370.58 g/mol, XLogP of 4.21, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-(dipropylcarbamoylamino)hexyl]-1,1-dipropylurea is sourced from PubChem (CID 3141105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).