C19H19N3O — CID 3141463
N-[(2-methoxyphenyl)methylideneamino]-4,8-dimethylquinolin-2-amine (PubChem CID 3141463) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methylideneamino]-4,8-dimethylquinolin-2-amine.
| Compound Name | N-[(2-methoxyphenyl)methylideneamino]-4,8-dimethylquinolin-2-amine |
|---|---|
| PubChem CID | 3141463 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | N-[(2-methoxyphenyl)methylideneamino]-4,8-dimethylquinolin-2-amine |
| SMILES | COc1ccccc1C=NNc1cc(C)c2cccc(C)c2n1 |
| InChI | InChI=1S/C19H19N3O/c1-13-7-6-9-16-14(2)11-18(21-19(13)16)22-20-12-15-8-4-5-10-17(15)23-3/h4-12H,1-3H3,(H,21,22) |
| InChIKey | HVTCLLTVEJQVPB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|