C21H22FN3O4S — CID 3141795
3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide (PubChem CID 3141795) has the molecular formula C21H22FN3O4S and a molecular weight of 431.49 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 3141795 |
| Molecular Formula | C21H22FN3O4S |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-fluorophenyl)imino-4-oxo-1,3-thiazinane-6-carboxamide |
| SMILES | COc1ccc(CCN2C(=O)CC(C(N)=O)S/C2=N\c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C21H22FN3O4S/c1-28-16-8-3-13(11-17(16)29-2)9-10-25-19(26)12-18(20(23)27)30-21(25)24-15-6-4-14(22)5-7-15/h3-8,11,18H,9-10,12H2,1-2H3,(H2,23,27)/b24-21- |
| InChIKey | GBNDADKKVZCDAO-FLFQWRMESA-N |
| XLogP | 2.89 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|