C18H14F3N5O2 — CID 31418027
4-methyl-1-[[4-(trifluoromethoxy)anilino]methyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 31418027) has the molecular formula C18H14F3N5O2 and a molecular weight of 389.34 g/mol. Its IUPAC name is 4-methyl-1-[[4-(trifluoromethoxy)anilino]methyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 4-methyl-1-[[4-(trifluoromethoxy)anilino]methyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 31418027 |
| Molecular Formula | C18H14F3N5O2 |
| Molecular Weight | 389.34 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 4-methyl-1-[[4-(trifluoromethoxy)anilino]methyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | Cn1c(=O)c2ccccc2n2c(CNc3ccc(OC(F)(F)F)cc3)nnc12 |
| InChI | InChI=1S/C18H14F3N5O2/c1-25-16(27)13-4-2-3-5-14(13)26-15(23-24-17(25)26)10-22-11-6-8-12(9-7-11)28-18(19,20)21/h2-9,22H,10H2,1H3 |
| InChIKey | WXBZZICGBKQJLP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|