C16H12Cl2N2O — CID 31418197
N-(2,3-dichlorophenyl)-2-(3-ethynylanilino)acetamide (PubChem CID 31418197) has the molecular formula C16H12Cl2N2O and a molecular weight of 319.19 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-(3-ethynylanilino)acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-(3-ethynylanilino)acetamide |
|---|---|
| PubChem CID | 31418197 |
| Molecular Formula | C16H12Cl2N2O |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-(3-ethynylanilino)acetamide |
| SMILES | C#Cc1cccc(NCC(=O)Nc2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C16H12Cl2N2O/c1-2-11-5-3-6-12(9-11)19-10-15(21)20-14-8-4-7-13(17)16(14)18/h1,3-9,19H,10H2,(H,20,21) |
| InChIKey | POUPYJNTLBTGAG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|