C20H25NO — CID 3142092
3,4,5-trimethyl-2,6-diphenylpiperidin-4-ol (PubChem CID 3142092) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is 3,4,5-trimethyl-2,6-diphenylpiperidin-4-ol.
| Compound Name | 3,4,5-trimethyl-2,6-diphenylpiperidin-4-ol |
|---|---|
| PubChem CID | 3142092 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 3,4,5-trimethyl-2,6-diphenylpiperidin-4-ol |
| SMILES | CC1C(c2ccccc2)NC(c2ccccc2)C(C)C1(C)O |
| InChI | InChI=1S/C20H25NO/c1-14-18(16-10-6-4-7-11-16)21-19(15(2)20(14,3)22)17-12-8-5-9-13-17/h4-15,18-19,21-22H,1-3H3 |
| InChIKey | PPULLACTYCCYOK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |