C14H21N — CID 3142211
2,2,4,6,7-pentamethyl-3,4-dihydro-1H-quinoline (PubChem CID 3142211) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 2,2,4,6,7-pentamethyl-3,4-dihydro-1H-quinoline.
| Compound Name | 2,2,4,6,7-pentamethyl-3,4-dihydro-1H-quinoline |
|---|---|
| PubChem CID | 3142211 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 2,2,4,6,7-pentamethyl-3,4-dihydro-1H-quinoline |
| SMILES | Cc1cc2c(cc1C)C(C)CC(C)(C)N2 |
| InChI | InChI=1S/C14H21N/c1-9-6-12-11(3)8-14(4,5)15-13(12)7-10(9)2/h6-7,11,15H,8H2,1-5H3 |
| InChIKey | ZHYQUVAZTCEITH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |