About 2-hydroxy-2,2-diphenyl-N'-propylacetohydrazide
2-hydroxy-2,2-diphenyl-N'-propylacetohydrazide (PubChem CID 3142793) has the molecular formula C17H20N2O2
and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-hydroxy-2,2-diphenyl-N'-propylacetohydrazide.
Molecular Properties
| Compound Name | 2-hydroxy-2,2-diphenyl-N'-propylacetohydrazide |
| PubChem CID | 3142793 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 2-hydroxy-2,2-diphenyl-N'-propylacetohydrazide |
| SMILES | CCCNNC(=O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20N2O2/c1-2-13-18-19-16(20)17(21,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,18,21H,2,13H2,1H3,(H,19,20) |
| InChIKey | VHXVQVYPRKPNKA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-2,2-diphenyl-N'-propylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2,2-diphenyl-N'-propylacetohydrazide?
The IUPAC name of 2-hydroxy-2,2-diphenyl-N'-propylacetohydrazide (CID 3142793) is 2-hydroxy-2,2-diphenyl-N'-propylacetohydrazide.
What is the SMILES notation for 2-hydroxy-2,2-diphenyl-N'-propylacetohydrazide?
The canonical SMILES for 2-hydroxy-2,2-diphenyl-N'-propylacetohydrazide is CCCNNC(=O)C(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-hydroxy-2,2-diphenyl-N'-propylacetohydrazide?
The InChIKey is VHXVQVYPRKPNKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O2/c1-2-13-18-19-16(20)17(21,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,18,21H,2,13H2,1H3,(H,19,20).
What are the key properties of 2-hydroxy-2,2-diphenyl-N'-propylacetohydrazide?
2-hydroxy-2,2-diphenyl-N'-propylacetohydrazide has a molecular weight of 284.36 g/mol, XLogP of 1.95, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2,2-diphenyl-N'-propylacetohydrazide is sourced from PubChem (CID 3142793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).