About 5-ethyl-3,3-dimethyl-6-(4-nitrophenyl)oxane-2,4-dione
5-ethyl-3,3-dimethyl-6-(4-nitrophenyl)oxane-2,4-dione (PubChem CID 3142960) has the molecular formula C15H17NO5
and a molecular weight of 291.30 g/mol. Its IUPAC name is 5-ethyl-3,3-dimethyl-6-(4-nitrophenyl)oxane-2,4-dione.
Molecular Properties
| Compound Name | 5-ethyl-3,3-dimethyl-6-(4-nitrophenyl)oxane-2,4-dione |
| PubChem CID | 3142960 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 5-ethyl-3,3-dimethyl-6-(4-nitrophenyl)oxane-2,4-dione |
| SMILES | CCC1C(=O)C(C)(C)C(=O)OC1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H17NO5/c1-4-11-12(21-14(18)15(2,3)13(11)17)9-5-7-10(8-6-9)16(19)20/h5-8,11-12H,4H2,1-3H3 |
| InChIKey | LCBGEFYZUIYPGO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-3,3-dimethyl-6-(4-nitrophenyl)oxane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-3,3-dimethyl-6-(4-nitrophenyl)oxane-2,4-dione?
The IUPAC name of 5-ethyl-3,3-dimethyl-6-(4-nitrophenyl)oxane-2,4-dione (CID 3142960) is 5-ethyl-3,3-dimethyl-6-(4-nitrophenyl)oxane-2,4-dione.
What is the SMILES notation for 5-ethyl-3,3-dimethyl-6-(4-nitrophenyl)oxane-2,4-dione?
The canonical SMILES for 5-ethyl-3,3-dimethyl-6-(4-nitrophenyl)oxane-2,4-dione is CCC1C(=O)C(C)(C)C(=O)OC1c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 5-ethyl-3,3-dimethyl-6-(4-nitrophenyl)oxane-2,4-dione?
The InChIKey is LCBGEFYZUIYPGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO5/c1-4-11-12(21-14(18)15(2,3)13(11)17)9-5-7-10(8-6-9)16(19)20/h5-8,11-12H,4H2,1-3H3.
What are the key properties of 5-ethyl-3,3-dimethyl-6-(4-nitrophenyl)oxane-2,4-dione?
5-ethyl-3,3-dimethyl-6-(4-nitrophenyl)oxane-2,4-dione has a molecular weight of 291.30 g/mol, XLogP of 2.81, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-3,3-dimethyl-6-(4-nitrophenyl)oxane-2,4-dione is sourced from PubChem (CID 3142960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).