C25H27N3O4S — CID 31429984
4-(benzenesulfonamido)-N-[(1R)-2-morpholin-4-yl-1-phenylethyl]benzamide (PubChem CID 31429984) has the molecular formula C25H27N3O4S and a molecular weight of 465.58 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-N-[(1R)-2-morpholin-4-yl-1-phenylethyl]benzamide.
| Compound Name | 4-(benzenesulfonamido)-N-[(1R)-2-morpholin-4-yl-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 31429984 |
| Molecular Formula | C25H27N3O4S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 4-(benzenesulfonamido)-N-[(1R)-2-morpholin-4-yl-1-phenylethyl]benzamide |
| SMILES | O=C(N[C@@H](CN1CCOCC1)c1ccccc1)c1ccc(NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H27N3O4S/c29-25(26-24(20-7-3-1-4-8-20)19-28-15-17-32-18-16-28)21-11-13-22(14-12-21)27-33(30,31)23-9-5-2-6-10-23/h1-14,24,27H,15-19H2,(H,26,29)/t24-/m0/s1 |
| InChIKey | BBRCKMFDAMJPJZ-DEOSSOPVSA-N |
| XLogP | 3.29 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |