C13H19N — CID 3143282
4-ethenyl-2,6-bis(prop-2-enyl)-1,2,3,6-tetrahydropyridine (PubChem CID 3143282) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 4-ethenyl-2,6-bis(prop-2-enyl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-ethenyl-2,6-bis(prop-2-enyl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 3143282 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 4-ethenyl-2,6-bis(prop-2-enyl)-1,2,3,6-tetrahydropyridine |
| SMILES | C=CCC1C=C(C=C)CC(CC=C)N1 |
| InChI | InChI=1S/C13H19N/c1-4-7-12-9-11(6-3)10-13(14-12)8-5-2/h4-6,9,12-14H,1-3,7-8,10H2 |
| InChIKey | KBXHPBIUZZCCJG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|