About N-ethyl-N-[4-[[4-(4-fluorobenzoyl)phenoxy]methyl]-1,3-thiazol-2-yl]acetamide
N-ethyl-N-[4-[[4-(4-fluorobenzoyl)phenoxy]methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 31433095) has the molecular formula C21H19FN2O3S
and a molecular weight of 398.46 g/mol. Its IUPAC name is N-ethyl-N-[4-[[4-(4-fluorobenzoyl)phenoxy]methyl]-1,3-thiazol-2-yl]acetamide.
Molecular Properties
| Compound Name | N-ethyl-N-[4-[[4-(4-fluorobenzoyl)phenoxy]methyl]-1,3-thiazol-2-yl]acetamide |
| PubChem CID | 31433095 |
| Molecular Formula | C21H19FN2O3S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | N-ethyl-N-[4-[[4-(4-fluorobenzoyl)phenoxy]methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CCN(C(C)=O)c1nc(COc2ccc(C(=O)c3ccc(F)cc3)cc2)cs1 |
| InChI | InChI=1S/C21H19FN2O3S/c1-3-24(14(2)25)21-23-18(13-28-21)12-27-19-10-6-16(7-11-19)20(26)15-4-8-17(22)9-5-15/h4-11,13H,3,12H2,1-2H3 |
| InChIKey | WYQQLPVCASTWGH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-ethyl-N-[4-[[4-(4-fluorobenzoyl)phenoxy]methyl]-1,3-thiazol-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-[4-[[4-(4-fluorobenzoyl)phenoxy]methyl]-1,3-thiazol-2-yl]acetamide?
The IUPAC name of N-ethyl-N-[4-[[4-(4-fluorobenzoyl)phenoxy]methyl]-1,3-thiazol-2-yl]acetamide (CID 31433095) is N-ethyl-N-[4-[[4-(4-fluorobenzoyl)phenoxy]methyl]-1,3-thiazol-2-yl]acetamide.
What is the SMILES notation for N-ethyl-N-[4-[[4-(4-fluorobenzoyl)phenoxy]methyl]-1,3-thiazol-2-yl]acetamide?
The canonical SMILES for N-ethyl-N-[4-[[4-(4-fluorobenzoyl)phenoxy]methyl]-1,3-thiazol-2-yl]acetamide is CCN(C(C)=O)c1nc(COc2ccc(C(=O)c3ccc(F)cc3)cc2)cs1.
What is the InChIKey of N-ethyl-N-[4-[[4-(4-fluorobenzoyl)phenoxy]methyl]-1,3-thiazol-2-yl]acetamide?
The InChIKey is WYQQLPVCASTWGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19FN2O3S/c1-3-24(14(2)25)21-23-18(13-28-21)12-27-19-10-6-16(7-11-19)20(26)15-4-8-17(22)9-5-15/h4-11,13H,3,12H2,1-2H3.
What are the key properties of N-ethyl-N-[4-[[4-(4-fluorobenzoyl)phenoxy]methyl]-1,3-thiazol-2-yl]acetamide?
N-ethyl-N-[4-[[4-(4-fluorobenzoyl)phenoxy]methyl]-1,3-thiazol-2-yl]acetamide has a molecular weight of 398.46 g/mol, XLogP of 4.47, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-[4-[[4-(4-fluorobenzoyl)phenoxy]methyl]-1,3-thiazol-2-yl]acetamide is sourced from PubChem (CID 31433095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).