C26H26N4O5S — CID 3143602
2-[3-[[1-(4-ethoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]indol-1-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 3143602) has the molecular formula C26H26N4O5S and a molecular weight of 506.58 g/mol. Its IUPAC name is 2-[3-[[1-(4-ethoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]indol-1-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[3-[[1-(4-ethoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]indol-1-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 3143602 |
| Molecular Formula | C26H26N4O5S |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | 2-[3-[[1-(4-ethoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]indol-1-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | CCOc1ccc(N2C(=O)C(=Cc3cn(CC(=O)NCCOC)c4ccccc34)C(=O)NC2=S)cc1 |
| InChI | InChI=1S/C26H26N4O5S/c1-3-35-19-10-8-18(9-11-19)30-25(33)21(24(32)28-26(30)36)14-17-15-29(16-23(31)27-12-13-34-2)22-7-5-4-6-20(17)22/h4-11,14-15H,3,12-13,16H2,1-2H3,(H,27,31)(H,28,32,36) |
| InChIKey | JHFGCUDNDIKOER-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|