C33H23F3N4O5S — CID 3144007
N-[4-(3-nitro-5-phenoxyphenoxy)phenyl]-2-[[4-(trifluoromethyl)-5,6-dihydrobenzo[h]quinazolin-2-yl]sulfanyl]acetamide (PubChem CID 3144007) has the molecular formula C33H23F3N4O5S and a molecular weight of 644.63 g/mol. Its IUPAC name is N-[4-(3-nitro-5-phenoxyphenoxy)phenyl]-2-[[4-(trifluoromethyl)-5,6-dihydrobenzo[h]quinazolin-2-yl]sulfanyl]acetamide.
| Compound Name | N-[4-(3-nitro-5-phenoxyphenoxy)phenyl]-2-[[4-(trifluoromethyl)-5,6-dihydrobenzo[h]quinazolin-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3144007 |
| Molecular Formula | C33H23F3N4O5S |
| Molecular Weight | 644.63 g/mol |
| Exact Mass | 644.13 |
| IUPAC Name | N-[4-(3-nitro-5-phenoxyphenoxy)phenyl]-2-[[4-(trifluoromethyl)-5,6-dihydrobenzo[h]quinazolin-2-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nc2c(c(C(F)(F)F)n1)CCc1ccccc1-2)Nc1ccc(Oc2cc(Oc3ccccc3)cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C33H23F3N4O5S/c34-33(35,36)31-28-15-10-20-6-4-5-9-27(20)30(28)38-32(39-31)46-19-29(41)37-21-11-13-24(14-12-21)45-26-17-22(40(42)43)16-25(18-26)44-23-7-2-1-3-8-23/h1-9,11-14,16-18H,10,15,19H2,(H,37,41) |
| InChIKey | GUXCUQCHZXJFAY-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.63 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|