C23H18FN3O4 — CID 3144302
9-(4-fluorophenyl)-6-(5-nitrofuran-2-yl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 3144302) has the molecular formula C23H18FN3O4 and a molecular weight of 419.41 g/mol. Its IUPAC name is 9-(4-fluorophenyl)-6-(5-nitrofuran-2-yl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 9-(4-fluorophenyl)-6-(5-nitrofuran-2-yl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 3144302 |
| Molecular Formula | C23H18FN3O4 |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 9-(4-fluorophenyl)-6-(5-nitrofuran-2-yl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | O=C1CC(c2ccc(F)cc2)CC2=C1C(c1ccc([N+](=O)[O-])o1)Nc1ccccc1N2 |
| InChI | InChI=1S/C23H18FN3O4/c24-15-7-5-13(6-8-15)14-11-18-22(19(28)12-14)23(20-9-10-21(31-20)27(29)30)26-17-4-2-1-3-16(17)25-18/h1-10,14,23,25-26H,11-12H2 |
| InChIKey | ZYMCLTCVNSEGKS-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|