About ethyl 4-amino-2-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate
ethyl 4-amino-2-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate (PubChem CID 3144984) has the molecular formula C17H20N4O5S
and a molecular weight of 392.44 g/mol. Its IUPAC name is ethyl 4-amino-2-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-amino-2-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate |
| PubChem CID | 3144984 |
| Molecular Formula | C17H20N4O5S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | ethyl 4-amino-2-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SCC(=O)Nc2cc(OC)ccc2OC)nc1N |
| InChI | InChI=1S/C17H20N4O5S/c1-4-26-16(23)11-8-19-17(21-15(11)18)27-9-14(22)20-12-7-10(24-2)5-6-13(12)25-3/h5-8H,4,9H2,1-3H3,(H,20,22)(H2,18,19,21) |
| InChIKey | ZEUJWJJJGQIZDZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 125.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze ethyl 4-amino-2-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-amino-2-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate?
The IUPAC name of ethyl 4-amino-2-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate (CID 3144984) is ethyl 4-amino-2-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate.
What is the SMILES notation for ethyl 4-amino-2-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate?
The canonical SMILES for ethyl 4-amino-2-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate is CCOC(=O)c1cnc(SCC(=O)Nc2cc(OC)ccc2OC)nc1N.
What is the InChIKey of ethyl 4-amino-2-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate?
The InChIKey is ZEUJWJJJGQIZDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N4O5S/c1-4-26-16(23)11-8-19-17(21-15(11)18)27-9-14(22)20-12-7-10(24-2)5-6-13(12)25-3/h5-8H,4,9H2,1-3H3,(H,20,22)(H2,18,19,21).
What are the key properties of ethyl 4-amino-2-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate?
ethyl 4-amino-2-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate has a molecular weight of 392.44 g/mol, XLogP of 1.98, 8 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-amino-2-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate is sourced from PubChem (CID 3144984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).