About 1-[3-(2,2-dimethyloxan-4-yl)-3-(4-methoxyphenyl)propyl]pyrrolidine-2,5-dione
1-[3-(2,2-dimethyloxan-4-yl)-3-(4-methoxyphenyl)propyl]pyrrolidine-2,5-dione (PubChem CID 3145043) has the molecular formula C21H29NO4
and a molecular weight of 359.47 g/mol. Its IUPAC name is 1-[3-(2,2-dimethyloxan-4-yl)-3-(4-methoxyphenyl)propyl]pyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 1-[3-(2,2-dimethyloxan-4-yl)-3-(4-methoxyphenyl)propyl]pyrrolidine-2,5-dione |
| PubChem CID | 3145043 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 1-[3-(2,2-dimethyloxan-4-yl)-3-(4-methoxyphenyl)propyl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc(C(CCN2C(=O)CCC2=O)C2CCOC(C)(C)C2)cc1 |
| InChI | InChI=1S/C21H29NO4/c1-21(2)14-16(11-13-26-21)18(15-4-6-17(25-3)7-5-15)10-12-22-19(23)8-9-20(22)24/h4-7,16,18H,8-14H2,1-3H3 |
| InChIKey | KUHHZVQXQUWEPY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(2,2-dimethyloxan-4-yl)-3-(4-methoxyphenyl)propyl]pyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2,2-dimethyloxan-4-yl)-3-(4-methoxyphenyl)propyl]pyrrolidine-2,5-dione?
The IUPAC name of 1-[3-(2,2-dimethyloxan-4-yl)-3-(4-methoxyphenyl)propyl]pyrrolidine-2,5-dione (CID 3145043) is 1-[3-(2,2-dimethyloxan-4-yl)-3-(4-methoxyphenyl)propyl]pyrrolidine-2,5-dione.
What is the SMILES notation for 1-[3-(2,2-dimethyloxan-4-yl)-3-(4-methoxyphenyl)propyl]pyrrolidine-2,5-dione?
The canonical SMILES for 1-[3-(2,2-dimethyloxan-4-yl)-3-(4-methoxyphenyl)propyl]pyrrolidine-2,5-dione is COc1ccc(C(CCN2C(=O)CCC2=O)C2CCOC(C)(C)C2)cc1.
What is the InChIKey of 1-[3-(2,2-dimethyloxan-4-yl)-3-(4-methoxyphenyl)propyl]pyrrolidine-2,5-dione?
The InChIKey is KUHHZVQXQUWEPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29NO4/c1-21(2)14-16(11-13-26-21)18(15-4-6-17(25-3)7-5-15)10-12-22-19(23)8-9-20(22)24/h4-7,16,18H,8-14H2,1-3H3.
What are the key properties of 1-[3-(2,2-dimethyloxan-4-yl)-3-(4-methoxyphenyl)propyl]pyrrolidine-2,5-dione?
1-[3-(2,2-dimethyloxan-4-yl)-3-(4-methoxyphenyl)propyl]pyrrolidine-2,5-dione has a molecular weight of 359.47 g/mol, XLogP of 3.52, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2,2-dimethyloxan-4-yl)-3-(4-methoxyphenyl)propyl]pyrrolidine-2,5-dione is sourced from PubChem (CID 3145043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).