About 3-(1,3-dioxoisoindol-2-yl)-N-(3-imidazol-1-ylpropyl)propanamide
3-(1,3-dioxoisoindol-2-yl)-N-(3-imidazol-1-ylpropyl)propanamide (PubChem CID 3145245) has the molecular formula C17H18N4O3
and a molecular weight of 326.36 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-(3-imidazol-1-ylpropyl)propanamide.
Molecular Properties
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-(3-imidazol-1-ylpropyl)propanamide |
| PubChem CID | 3145245 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-(3-imidazol-1-ylpropyl)propanamide |
| SMILES | O=C(CCN1C(=O)c2ccccc2C1=O)NCCCn1ccnc1 |
| InChI | InChI=1S/C17H18N4O3/c22-15(19-7-3-9-20-11-8-18-12-20)6-10-21-16(23)13-4-1-2-5-14(13)17(21)24/h1-2,4-5,8,11-12H,3,6-7,9-10H2,(H,19,22) |
| InChIKey | ULPVGUFCPLYDIK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,3-dioxoisoindol-2-yl)-N-(3-imidazol-1-ylpropyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-dioxoisoindol-2-yl)-N-(3-imidazol-1-ylpropyl)propanamide?
The IUPAC name of 3-(1,3-dioxoisoindol-2-yl)-N-(3-imidazol-1-ylpropyl)propanamide (CID 3145245) is 3-(1,3-dioxoisoindol-2-yl)-N-(3-imidazol-1-ylpropyl)propanamide.
What is the SMILES notation for 3-(1,3-dioxoisoindol-2-yl)-N-(3-imidazol-1-ylpropyl)propanamide?
The canonical SMILES for 3-(1,3-dioxoisoindol-2-yl)-N-(3-imidazol-1-ylpropyl)propanamide is O=C(CCN1C(=O)c2ccccc2C1=O)NCCCn1ccnc1.
What is the InChIKey of 3-(1,3-dioxoisoindol-2-yl)-N-(3-imidazol-1-ylpropyl)propanamide?
The InChIKey is ULPVGUFCPLYDIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N4O3/c22-15(19-7-3-9-20-11-8-18-12-20)6-10-21-16(23)13-4-1-2-5-14(13)17(21)24/h1-2,4-5,8,11-12H,3,6-7,9-10H2,(H,19,22).
What are the key properties of 3-(1,3-dioxoisoindol-2-yl)-N-(3-imidazol-1-ylpropyl)propanamide?
3-(1,3-dioxoisoindol-2-yl)-N-(3-imidazol-1-ylpropyl)propanamide has a molecular weight of 326.36 g/mol, XLogP of 1.08, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-dioxoisoindol-2-yl)-N-(3-imidazol-1-ylpropyl)propanamide is sourced from PubChem (CID 3145245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).