C30H41NO5 — CID 3145383
9-(3-ethoxy-4-methoxyphenyl)-10-(3-methoxypropyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 3145383) has the molecular formula C30H41NO5 and a molecular weight of 495.66 g/mol. Its IUPAC name is 9-(3-ethoxy-4-methoxyphenyl)-10-(3-methoxypropyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 9-(3-ethoxy-4-methoxyphenyl)-10-(3-methoxypropyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 3145383 |
| Molecular Formula | C30H41NO5 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.30 |
| IUPAC Name | 9-(3-ethoxy-4-methoxyphenyl)-10-(3-methoxypropyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | CCOc1cc(C2C3=C(CC(C)(C)CC3=O)N(CCCOC)C3=C2C(=O)CC(C)(C)C3)ccc1OC |
| InChI | InChI=1S/C30H41NO5/c1-8-36-25-14-19(10-11-24(25)35-7)26-27-20(15-29(2,3)17-22(27)32)31(12-9-13-34-6)21-16-30(4,5)18-23(33)28(21)26/h10-11,14,26H,8-9,12-13,15-18H2,1-7H3 |
| InChIKey | LBXVWKCWTXPIGJ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|