About 1-pentylchromeno[3,4-d]triazol-4-one
1-pentylchromeno[3,4-d]triazol-4-one (PubChem CID 3145906) has the molecular formula C14H15N3O2
and a molecular weight of 257.29 g/mol. Its IUPAC name is 1-pentylchromeno[3,4-d]triazol-4-one.
Molecular Properties
| Compound Name | 1-pentylchromeno[3,4-d]triazol-4-one |
| PubChem CID | 3145906 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 1-pentylchromeno[3,4-d]triazol-4-one |
| SMILES | CCCCCn1nnc2c(=O)oc3ccccc3c21 |
| InChI | InChI=1S/C14H15N3O2/c1-2-3-6-9-17-13-10-7-4-5-8-11(10)19-14(18)12(13)15-16-17/h4-5,7-8H,2-3,6,9H2,1H3 |
| InChIKey | LHDPKWKYGBRRCX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 1-pentylchromeno[3,4-d]triazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentylchromeno[3,4-d]triazol-4-one?
The IUPAC name of 1-pentylchromeno[3,4-d]triazol-4-one (CID 3145906) is 1-pentylchromeno[3,4-d]triazol-4-one.
What is the SMILES notation for 1-pentylchromeno[3,4-d]triazol-4-one?
The canonical SMILES for 1-pentylchromeno[3,4-d]triazol-4-one is CCCCCn1nnc2c(=O)oc3ccccc3c21.
What is the InChIKey of 1-pentylchromeno[3,4-d]triazol-4-one?
The InChIKey is LHDPKWKYGBRRCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O2/c1-2-3-6-9-17-13-10-7-4-5-8-11(10)19-14(18)12(13)15-16-17/h4-5,7-8H,2-3,6,9H2,1H3.
What are the key properties of 1-pentylchromeno[3,4-d]triazol-4-one?
1-pentylchromeno[3,4-d]triazol-4-one has a molecular weight of 257.29 g/mol, XLogP of 2.73, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentylchromeno[3,4-d]triazol-4-one is sourced from PubChem (CID 3145906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).