C14H13F3N2O4S — CID 3146053
2-amino-3-[2,5-dioxo-1-[2-(trifluoromethyl)phenyl]pyrrolidin-3-yl]sulfanylpropanoic acid (PubChem CID 3146053) has the molecular formula C14H13F3N2O4S and a molecular weight of 362.33 g/mol. Its IUPAC name is 2-amino-3-[2,5-dioxo-1-[2-(trifluoromethyl)phenyl]pyrrolidin-3-yl]sulfanylpropanoic acid.
| Compound Name | 2-amino-3-[2,5-dioxo-1-[2-(trifluoromethyl)phenyl]pyrrolidin-3-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 3146053 |
| Molecular Formula | C14H13F3N2O4S |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 2-amino-3-[2,5-dioxo-1-[2-(trifluoromethyl)phenyl]pyrrolidin-3-yl]sulfanylpropanoic acid |
| SMILES | NC(CSC1CC(=O)N(c2ccccc2C(F)(F)F)C1=O)C(=O)O |
| InChI | InChI=1S/C14H13F3N2O4S/c15-14(16,17)7-3-1-2-4-9(7)19-11(20)5-10(12(19)21)24-6-8(18)13(22)23/h1-4,8,10H,5-6,18H2,(H,22,23) |
| InChIKey | ODZCNACBSGCAKO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|