About N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)acetamide
N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)acetamide (PubChem CID 3146107) has the molecular formula C10H12N2O3
and a molecular weight of 208.22 g/mol. Its IUPAC name is N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)acetamide.
Molecular Properties
| Compound Name | N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)acetamide |
| PubChem CID | 3146107 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)acetamide |
| SMILES | CC(=O)Nc1cc2c(cc1N)OCCO2 |
| InChI | InChI=1S/C10H12N2O3/c1-6(13)12-8-5-10-9(4-7(8)11)14-2-3-15-10/h4-5H,2-3,11H2,1H3,(H,12,13) |
| InChIKey | LJXBBVIIWHUUSY-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)acetamide?
The IUPAC name of N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)acetamide (CID 3146107) is N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)acetamide.
What is the SMILES notation for N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)acetamide?
The canonical SMILES for N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)acetamide is CC(=O)Nc1cc2c(cc1N)OCCO2.
What is the InChIKey of N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)acetamide?
The InChIKey is LJXBBVIIWHUUSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O3/c1-6(13)12-8-5-10-9(4-7(8)11)14-2-3-15-10/h4-5H,2-3,11H2,1H3,(H,12,13).
What are the key properties of N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)acetamide?
N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)acetamide has a molecular weight of 208.22 g/mol, XLogP of 1.00, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)acetamide is sourced from PubChem (CID 3146107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).