C19H22F3NO7 — CID 3146277
4,4,11,11-tetramethyl-N-[4-(trifluoromethoxy)phenyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide (PubChem CID 3146277) has the molecular formula C19H22F3NO7 and a molecular weight of 433.38 g/mol. Its IUPAC name is 4,4,11,11-tetramethyl-N-[4-(trifluoromethoxy)phenyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide.
| Compound Name | 4,4,11,11-tetramethyl-N-[4-(trifluoromethoxy)phenyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
|---|---|
| PubChem CID | 3146277 |
| Molecular Formula | C19H22F3NO7 |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 4,4,11,11-tetramethyl-N-[4-(trifluoromethoxy)phenyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
| SMILES | CC1(C)OC2OC(C(=O)Nc3ccc(OC(F)(F)F)cc3)C3OC(C)(C)OC3C2O1 |
| InChI | InChI=1S/C19H22F3NO7/c1-17(2)27-11-12(28-17)14-16(30-18(3,4)29-14)25-13(11)15(24)23-9-5-7-10(8-6-9)26-19(20,21)22/h5-8,11-14,16H,1-4H3,(H,23,24) |
| InChIKey | DYPWYALADNLMHN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |