C12H14ClN5O2 — CID 3146888
2-[[4-chloro-6-(4-methoxyanilino)-1,3,5-triazin-2-yl]amino]ethanol (PubChem CID 3146888) has the molecular formula C12H14ClN5O2 and a molecular weight of 295.73 g/mol. Its IUPAC name is 2-[[4-chloro-6-(4-methoxyanilino)-1,3,5-triazin-2-yl]amino]ethanol.
| Compound Name | 2-[[4-chloro-6-(4-methoxyanilino)-1,3,5-triazin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 3146888 |
| Molecular Formula | C12H14ClN5O2 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 2-[[4-chloro-6-(4-methoxyanilino)-1,3,5-triazin-2-yl]amino]ethanol |
| SMILES | COc1ccc(Nc2nc(Cl)nc(NCCO)n2)cc1 |
| InChI | InChI=1S/C12H14ClN5O2/c1-20-9-4-2-8(3-5-9)15-12-17-10(13)16-11(18-12)14-6-7-19/h2-5,19H,6-7H2,1H3,(H2,14,15,16,17,18) |
| InChIKey | UIQGEJJMXUFJGB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 92.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |