About 1,3-diethyl-4,5-dihydroxyimidazolidin-2-one
1,3-diethyl-4,5-dihydroxyimidazolidin-2-one (PubChem CID 3146906) has the molecular formula C7H14N2O3
and a molecular weight of 174.20 g/mol. Its IUPAC name is 1,3-diethyl-4,5-dihydroxyimidazolidin-2-one.
Molecular Properties
| Compound Name | 1,3-diethyl-4,5-dihydroxyimidazolidin-2-one |
| PubChem CID | 3146906 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 1,3-diethyl-4,5-dihydroxyimidazolidin-2-one |
| SMILES | CCN1C(=O)N(CC)C(O)C1O |
| InChI | InChI=1S/C7H14N2O3/c1-3-8-5(10)6(11)9(4-2)7(8)12/h5-6,10-11H,3-4H2,1-2H3 |
| InChIKey | HAEJKWYMBFWXMQ-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-diethyl-4,5-dihydroxyimidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diethyl-4,5-dihydroxyimidazolidin-2-one?
The IUPAC name of 1,3-diethyl-4,5-dihydroxyimidazolidin-2-one (CID 3146906) is 1,3-diethyl-4,5-dihydroxyimidazolidin-2-one.
What is the SMILES notation for 1,3-diethyl-4,5-dihydroxyimidazolidin-2-one?
The canonical SMILES for 1,3-diethyl-4,5-dihydroxyimidazolidin-2-one is CCN1C(=O)N(CC)C(O)C1O.
What is the InChIKey of 1,3-diethyl-4,5-dihydroxyimidazolidin-2-one?
The InChIKey is HAEJKWYMBFWXMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O3/c1-3-8-5(10)6(11)9(4-2)7(8)12/h5-6,10-11H,3-4H2,1-2H3.
What are the key properties of 1,3-diethyl-4,5-dihydroxyimidazolidin-2-one?
1,3-diethyl-4,5-dihydroxyimidazolidin-2-one has a molecular weight of 174.20 g/mol, XLogP of -0.60, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diethyl-4,5-dihydroxyimidazolidin-2-one is sourced from PubChem (CID 3146906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).