C23H23N2O2+ — CID 3147
3-ethyl-2-[5-(3-ethyl-1,3-benzoxazol-3-ium-2-yl)penta-2,4-dienylidene]-1,3-benzoxazole (PubChem CID 3147) has the molecular formula C23H23N2O2+ and a molecular weight of 359.45 g/mol. Its IUPAC name is 3-ethyl-2-[5-(3-ethyl-1,3-benzoxazol-3-ium-2-yl)penta-2,4-dienylidene]-1,3-benzoxazole.
| Compound Name | 3-ethyl-2-[5-(3-ethyl-1,3-benzoxazol-3-ium-2-yl)penta-2,4-dienylidene]-1,3-benzoxazole |
|---|---|
| PubChem CID | 3147 |
| Molecular Formula | C23H23N2O2+ |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 3-ethyl-2-[5-(3-ethyl-1,3-benzoxazol-3-ium-2-yl)penta-2,4-dienylidene]-1,3-benzoxazole |
| SMILES | CCN1C(=CC=CC=Cc2oc3ccccc3[n+]2CC)Oc2ccccc21 |
| InChI | InChI=1S/C23H23N2O2/c1-3-24-18-12-8-10-14-20(18)26-22(24)16-6-5-7-17-23-25(4-2)19-13-9-11-15-21(19)27-23/h5-17H,3-4H2,1-2H3/q+1 |
| InChIKey | VAGJCLDZLVQVPR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 29.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|