About 5-methyl-N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]furan-2-carbohydrazide
5-methyl-N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]furan-2-carbohydrazide (PubChem CID 3147002) has the molecular formula C13H13F3N2O3
and a molecular weight of 302.25 g/mol. Its IUPAC name is 5-methyl-N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]furan-2-carbohydrazide.
Molecular Properties
| Compound Name | 5-methyl-N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]furan-2-carbohydrazide |
| PubChem CID | 3147002 |
| Molecular Formula | C13H13F3N2O3 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 5-methyl-N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]furan-2-carbohydrazide |
| SMILES | Cc1ccc(C(=O)NNC2=C(C(=O)C(F)(F)F)CCC2)o1 |
| InChI | InChI=1S/C13H13F3N2O3/c1-7-5-6-10(21-7)12(20)18-17-9-4-2-3-8(9)11(19)13(14,15)16/h5-6,17H,2-4H2,1H3,(H,18,20) |
| InChIKey | GHEZUPRJPMJKHE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]furan-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]furan-2-carbohydrazide?
The IUPAC name of 5-methyl-N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]furan-2-carbohydrazide (CID 3147002) is 5-methyl-N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]furan-2-carbohydrazide.
What is the SMILES notation for 5-methyl-N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]furan-2-carbohydrazide?
The canonical SMILES for 5-methyl-N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]furan-2-carbohydrazide is Cc1ccc(C(=O)NNC2=C(C(=O)C(F)(F)F)CCC2)o1.
What is the InChIKey of 5-methyl-N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]furan-2-carbohydrazide?
The InChIKey is GHEZUPRJPMJKHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F3N2O3/c1-7-5-6-10(21-7)12(20)18-17-9-4-2-3-8(9)11(19)13(14,15)16/h5-6,17H,2-4H2,1H3,(H,18,20).
What are the key properties of 5-methyl-N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]furan-2-carbohydrazide?
5-methyl-N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]furan-2-carbohydrazide has a molecular weight of 302.25 g/mol, XLogP of 2.39, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N'-[2-(2,2,2-trifluoroacetyl)cyclopenten-1-yl]furan-2-carbohydrazide is sourced from PubChem (CID 3147002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).