C20H23NO3 — CID 31472185
N-[3-acetyl-4-[(4-methylphenyl)methoxy]phenyl]butanamide (PubChem CID 31472185) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is N-[3-acetyl-4-[(4-methylphenyl)methoxy]phenyl]butanamide.
| Compound Name | N-[3-acetyl-4-[(4-methylphenyl)methoxy]phenyl]butanamide |
|---|---|
| PubChem CID | 31472185 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | N-[3-acetyl-4-[(4-methylphenyl)methoxy]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(OCc2ccc(C)cc2)c(C(C)=O)c1 |
| InChI | InChI=1S/C20H23NO3/c1-4-5-20(23)21-17-10-11-19(18(12-17)15(3)22)24-13-16-8-6-14(2)7-9-16/h6-12H,4-5,13H2,1-3H3,(H,21,23) |
| InChIKey | GRZGSOVXKNEEGC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |