About 6-methyl-4-nitro-1,3-benzothiazol-2-amine
6-methyl-4-nitro-1,3-benzothiazol-2-amine (PubChem CID 3147230) has the molecular formula C8H7N3O2S
and a molecular weight of 209.23 g/mol. Its IUPAC name is 6-methyl-4-nitro-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | 6-methyl-4-nitro-1,3-benzothiazol-2-amine |
| PubChem CID | 3147230 |
| Molecular Formula | C8H7N3O2S |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 6-methyl-4-nitro-1,3-benzothiazol-2-amine |
| SMILES | Cc1cc([N+](=O)[O-])c2nc(N)sc2c1 |
| InChI | InChI=1S/C8H7N3O2S/c1-4-2-5(11(12)13)7-6(3-4)14-8(9)10-7/h2-3H,1H3,(H2,9,10) |
| InChIKey | RCBABQGURHXXTH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-4-nitro-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-4-nitro-1,3-benzothiazol-2-amine?
The IUPAC name of 6-methyl-4-nitro-1,3-benzothiazol-2-amine (CID 3147230) is 6-methyl-4-nitro-1,3-benzothiazol-2-amine.
What is the SMILES notation for 6-methyl-4-nitro-1,3-benzothiazol-2-amine?
The canonical SMILES for 6-methyl-4-nitro-1,3-benzothiazol-2-amine is Cc1cc([N+](=O)[O-])c2nc(N)sc2c1.
What is the InChIKey of 6-methyl-4-nitro-1,3-benzothiazol-2-amine?
The InChIKey is RCBABQGURHXXTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2S/c1-4-2-5(11(12)13)7-6(3-4)14-8(9)10-7/h2-3H,1H3,(H2,9,10).
What are the key properties of 6-methyl-4-nitro-1,3-benzothiazol-2-amine?
6-methyl-4-nitro-1,3-benzothiazol-2-amine has a molecular weight of 209.23 g/mol, XLogP of 2.10, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-4-nitro-1,3-benzothiazol-2-amine is sourced from PubChem (CID 3147230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).