About 2-(2-methyl-3H-benzimidazol-5-yl)-1,3-benzoxazol-5-amine
2-(2-methyl-3H-benzimidazol-5-yl)-1,3-benzoxazol-5-amine (PubChem CID 3147263) has the molecular formula C15H12N4O
and a molecular weight of 264.29 g/mol. Its IUPAC name is 2-(2-methyl-3H-benzimidazol-5-yl)-1,3-benzoxazol-5-amine.
Molecular Properties
| Compound Name | 2-(2-methyl-3H-benzimidazol-5-yl)-1,3-benzoxazol-5-amine |
| PubChem CID | 3147263 |
| Molecular Formula | C15H12N4O |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-(2-methyl-3H-benzimidazol-5-yl)-1,3-benzoxazol-5-amine |
| SMILES | Cc1nc2ccc(-c3nc4cc(N)ccc4o3)cc2[nH]1 |
| InChI | InChI=1S/C15H12N4O/c1-8-17-11-4-2-9(6-12(11)18-8)15-19-13-7-10(16)3-5-14(13)20-15/h2-7H,16H2,1H3,(H,17,18) |
| InChIKey | USMSCRUBPSZWRK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methyl-3H-benzimidazol-5-yl)-1,3-benzoxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-3H-benzimidazol-5-yl)-1,3-benzoxazol-5-amine?
The IUPAC name of 2-(2-methyl-3H-benzimidazol-5-yl)-1,3-benzoxazol-5-amine (CID 3147263) is 2-(2-methyl-3H-benzimidazol-5-yl)-1,3-benzoxazol-5-amine.
What is the SMILES notation for 2-(2-methyl-3H-benzimidazol-5-yl)-1,3-benzoxazol-5-amine?
The canonical SMILES for 2-(2-methyl-3H-benzimidazol-5-yl)-1,3-benzoxazol-5-amine is Cc1nc2ccc(-c3nc4cc(N)ccc4o3)cc2[nH]1.
What is the InChIKey of 2-(2-methyl-3H-benzimidazol-5-yl)-1,3-benzoxazol-5-amine?
The InChIKey is USMSCRUBPSZWRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N4O/c1-8-17-11-4-2-9(6-12(11)18-8)15-19-13-7-10(16)3-5-14(13)20-15/h2-7H,16H2,1H3,(H,17,18).
What are the key properties of 2-(2-methyl-3H-benzimidazol-5-yl)-1,3-benzoxazol-5-amine?
2-(2-methyl-3H-benzimidazol-5-yl)-1,3-benzoxazol-5-amine has a molecular weight of 264.29 g/mol, XLogP of 3.26, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-3H-benzimidazol-5-yl)-1,3-benzoxazol-5-amine is sourced from PubChem (CID 3147263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).