C18H19N5O2S2 — CID 3147288
5-[[7-methyl-2-(4-methylpiperazin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3147288) has the molecular formula C18H19N5O2S2 and a molecular weight of 401.52 g/mol. Its IUPAC name is 5-[[7-methyl-2-(4-methylpiperazin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[7-methyl-2-(4-methylpiperazin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3147288 |
| Molecular Formula | C18H19N5O2S2 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 5-[[7-methyl-2-(4-methylpiperazin-1-yl)-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc2nc(N3CCN(C)CC3)c(C=C3SC(=S)NC3=O)c(=O)n2c1 |
| InChI | InChI=1S/C18H19N5O2S2/c1-11-3-4-14-19-15(22-7-5-21(2)6-8-22)12(17(25)23(14)10-11)9-13-16(24)20-18(26)27-13/h3-4,9-10H,5-8H2,1-2H3,(H,20,24,26) |
| InChIKey | BMQATAJIOYXADH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 69.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|