C19H31N3O3S — CID 31477878
2-[butyl(methyl)amino]-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 31477878) has the molecular formula C19H31N3O3S and a molecular weight of 381.54 g/mol. Its IUPAC name is 2-[butyl(methyl)amino]-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[butyl(methyl)amino]-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 31477878 |
| Molecular Formula | C19H31N3O3S |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 2-[butyl(methyl)amino]-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | CCCCN(C)CC(=O)Nc1cc(S(=O)(=O)N2CCCCC2)ccc1C |
| InChI | InChI=1S/C19H31N3O3S/c1-4-5-11-21(3)15-19(23)20-18-14-17(10-9-16(18)2)26(24,25)22-12-7-6-8-13-22/h9-10,14H,4-8,11-13,15H2,1-3H3,(H,20,23) |
| InChIKey | ZZDKQNWIIAJGAA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |