C15H23NO8 — CID 3148339
3-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl)amino]propanoic acid (PubChem CID 3148339) has the molecular formula C15H23NO8 and a molecular weight of 345.35 g/mol. Its IUPAC name is 3-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl)amino]propanoic acid.
| Compound Name | 3-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 3148339 |
| Molecular Formula | C15H23NO8 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 3-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl)amino]propanoic acid |
| SMILES | CC1(C)OC2OC(C(=O)NCCC(=O)O)C3OC(C)(C)OC3C2O1 |
| InChI | InChI=1S/C15H23NO8/c1-14(2)21-8-9(22-14)11-13(24-15(3,4)23-11)20-10(8)12(19)16-6-5-7(17)18/h8-11,13H,5-6H2,1-4H3,(H,16,19)(H,17,18) |
| InChIKey | SOJLRQMEBKAZHB-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |