C22H30N2O7 — CID 3148340
4,4,11,11-tetramethyl-N-[3-(4-methylanilino)-3-oxopropyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide (PubChem CID 3148340) has the molecular formula C22H30N2O7 and a molecular weight of 434.49 g/mol. Its IUPAC name is 4,4,11,11-tetramethyl-N-[3-(4-methylanilino)-3-oxopropyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide.
| Compound Name | 4,4,11,11-tetramethyl-N-[3-(4-methylanilino)-3-oxopropyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
|---|---|
| PubChem CID | 3148340 |
| Molecular Formula | C22H30N2O7 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 4,4,11,11-tetramethyl-N-[3-(4-methylanilino)-3-oxopropyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
| SMILES | Cc1ccc(NC(=O)CCNC(=O)C2OC3OC(C)(C)OC3C3OC(C)(C)OC23)cc1 |
| InChI | InChI=1S/C22H30N2O7/c1-12-6-8-13(9-7-12)24-14(25)10-11-23-19(26)17-15-16(29-21(2,3)28-15)18-20(27-17)31-22(4,5)30-18/h6-9,15-18,20H,10-11H2,1-5H3,(H,23,26)(H,24,25) |
| InChIKey | IXNXMPGKKJPONP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |