C22H20F3N3O4S — CID 3148404
N-benzyl-3-[4-(4-methoxyphenyl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfonylpropanamide (PubChem CID 3148404) has the molecular formula C22H20F3N3O4S and a molecular weight of 479.48 g/mol. Its IUPAC name is N-benzyl-3-[4-(4-methoxyphenyl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfonylpropanamide.
| Compound Name | N-benzyl-3-[4-(4-methoxyphenyl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfonylpropanamide |
|---|---|
| PubChem CID | 3148404 |
| Molecular Formula | C22H20F3N3O4S |
| Molecular Weight | 479.48 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | N-benzyl-3-[4-(4-methoxyphenyl)-6-(trifluoromethyl)pyrimidin-2-yl]sulfonylpropanamide |
| SMILES | COc1ccc(-c2cc(C(F)(F)F)nc(S(=O)(=O)CCC(=O)NCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C22H20F3N3O4S/c1-32-17-9-7-16(8-10-17)18-13-19(22(23,24)25)28-21(27-18)33(30,31)12-11-20(29)26-14-15-5-3-2-4-6-15/h2-10,13H,11-12,14H2,1H3,(H,26,29) |
| InChIKey | QKIVSJYRNXNPBI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |