C13H16N2O2S — CID 3148581
2-[(Z)-4-Ethoxy-phenylimino]-3-ethyl-thiazolidin-4-one (PubChem CID 3148581) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)imino-3-ethyl-1,3-thiazolidin-4-one.
| Compound Name | 2-[(Z)-4-Ethoxy-phenylimino]-3-ethyl-thiazolidin-4-one |
|---|---|
| PubChem CID | 3148581 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-(4-ethoxyphenyl)imino-3-ethyl-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)CSC1=NC2=CC=C(C=C2)OCC |
| InChI | InChI=1S/C13H16N2O2S/c1-3-15-12(16)9-18-13(15)14-10-5-7-11(8-6-10)17-4-2/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | XLVRVQDDVARTKF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 67.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | 325 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|