C18H13NO2S — CID 3148621
4-(4-methylphenyl)-1,4-dihydroindeno[1,2-d][1,3]thiazine-2,5-dione (PubChem CID 3148621) has the molecular formula C18H13NO2S and a molecular weight of 307.37 g/mol. Its IUPAC name is 4-(4-methylphenyl)-1,4-dihydroindeno[1,2-d][1,3]thiazine-2,5-dione.
| Compound Name | 4-(4-methylphenyl)-1,4-dihydroindeno[1,2-d][1,3]thiazine-2,5-dione |
|---|---|
| PubChem CID | 3148621 |
| Molecular Formula | C18H13NO2S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 4-(4-methylphenyl)-1,4-dihydroindeno[1,2-d][1,3]thiazine-2,5-dione |
| SMILES | Cc1ccc(C2SC(=O)NC3=C2C(=O)c2ccccc23)cc1 |
| InChI | InChI=1S/C18H13NO2S/c1-10-6-8-11(9-7-10)17-14-15(19-18(21)22-17)12-4-2-3-5-13(12)16(14)20/h2-9,17H,1H3,(H,19,21) |
| InChIKey | XQJCCIPREQEDJF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|