C19H21N5O3S — CID 3148785
ethyl 6-ethyl-2-([1,2,4]triazolo[1,5-a]pyrimidine-2-carbonylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 3148785) has the molecular formula C19H21N5O3S and a molecular weight of 399.48 g/mol. Its IUPAC name is ethyl 6-ethyl-2-([1,2,4]triazolo[1,5-a]pyrimidine-2-carbonylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 6-ethyl-2-([1,2,4]triazolo[1,5-a]pyrimidine-2-carbonylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3148785 |
| Molecular Formula | C19H21N5O3S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | ethyl 6-ethyl-2-([1,2,4]triazolo[1,5-a]pyrimidine-2-carbonylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2nc3ncccn3n2)sc2c1CCC(CC)C2 |
| InChI | InChI=1S/C19H21N5O3S/c1-3-11-6-7-12-13(10-11)28-17(14(12)18(26)27-4-2)22-16(25)15-21-19-20-8-5-9-24(19)23-15/h5,8-9,11H,3-4,6-7,10H2,1-2H3,(H,22,25) |
| InChIKey | OKHUGMUIFLYRDM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |