About 2-(4,6-diaminopyrimidin-2-yl)sulfanylbutanoic acid
2-(4,6-diaminopyrimidin-2-yl)sulfanylbutanoic acid (PubChem CID 3148944) has the molecular formula C8H12N4O2S
and a molecular weight of 228.28 g/mol. Its IUPAC name is 2-(4,6-diaminopyrimidin-2-yl)sulfanylbutanoic acid.
Molecular Properties
| Compound Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanylbutanoic acid |
| PubChem CID | 3148944 |
| Molecular Formula | C8H12N4O2S |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanylbutanoic acid |
| SMILES | CCC(Sc1nc(N)cc(N)n1)C(=O)O |
| InChI | InChI=1S/C8H12N4O2S/c1-2-4(7(13)14)15-8-11-5(9)3-6(10)12-8/h3-4H,2H2,1H3,(H,13,14)(H4,9,10,11,12) |
| InChIKey | SXVWYWGXRFRYMV-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 115.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4,6-diaminopyrimidin-2-yl)sulfanylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-diaminopyrimidin-2-yl)sulfanylbutanoic acid?
The IUPAC name of 2-(4,6-diaminopyrimidin-2-yl)sulfanylbutanoic acid (CID 3148944) is 2-(4,6-diaminopyrimidin-2-yl)sulfanylbutanoic acid.
What is the SMILES notation for 2-(4,6-diaminopyrimidin-2-yl)sulfanylbutanoic acid?
The canonical SMILES for 2-(4,6-diaminopyrimidin-2-yl)sulfanylbutanoic acid is CCC(Sc1nc(N)cc(N)n1)C(=O)O.
What is the InChIKey of 2-(4,6-diaminopyrimidin-2-yl)sulfanylbutanoic acid?
The InChIKey is SXVWYWGXRFRYMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O2S/c1-2-4(7(13)14)15-8-11-5(9)3-6(10)12-8/h3-4H,2H2,1H3,(H,13,14)(H4,9,10,11,12).
What are the key properties of 2-(4,6-diaminopyrimidin-2-yl)sulfanylbutanoic acid?
2-(4,6-diaminopyrimidin-2-yl)sulfanylbutanoic acid has a molecular weight of 228.28 g/mol, XLogP of 0.60, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-diaminopyrimidin-2-yl)sulfanylbutanoic acid is sourced from PubChem (CID 3148944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).