2-oxo-3H-1,3-benzothiazole-6-sulfonic acid

C7H5NO4S2 — CID 3149144

IUPAC2-oxo-3H-1,3-benzothiazole-6-sulfonic acid
SMILESO=c1[nH]c2ccc(S(=O)(=O)O)cc2s1
InChIInChI=1S/C7H5NO4S2/c9-7-8-5-2-1-4(14(10,11)12)3-6(5)13-7/h1-3H,(H,8,9)(H,10,11,12)
InChIKeyZSPDJLKUEUXBSG-UHFFFAOYSA-N
MW231.25 g/mol
LogP0.84
Rot. Bonds1

About 2-oxo-3H-1,3-benzothiazole-6-sulfonic acid

2-oxo-3H-1,3-benzothiazole-6-sulfonic acid (PubChem CID 3149144) has the molecular formula C7H5NO4S2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-oxo-3H-1,3-benzothiazole-6-sulfonic acid.

Molecular Properties

Compound Name2-oxo-3H-1,3-benzothiazole-6-sulfonic acid
PubChem CID3149144
Molecular FormulaC7H5NO4S2
Molecular Weight231.25 g/mol
Exact Mass230.97
IUPAC Name2-oxo-3H-1,3-benzothiazole-6-sulfonic acid
SMILESO=c1[nH]c2ccc(S(=O)(=O)O)cc2s1
InChIInChI=1S/C7H5NO4S2/c9-7-8-5-2-1-4(14(10,11)12)3-6(5)13-7/h1-3H,(H,8,9)(H,10,11,12)
InChIKeyZSPDJLKUEUXBSG-UHFFFAOYSA-N
XLogP0.84
TPSA87.23 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.25
LogP ≤ 50.84
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-oxo-3H-1,3-benzothiazole-6-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-oxo-3H-1,3-benzothiazole-6-sulfonic acid?
The IUPAC name of 2-oxo-3H-1,3-benzothiazole-6-sulfonic acid (CID 3149144) is 2-oxo-3H-1,3-benzothiazole-6-sulfonic acid.
What is the SMILES notation for 2-oxo-3H-1,3-benzothiazole-6-sulfonic acid?
The canonical SMILES for 2-oxo-3H-1,3-benzothiazole-6-sulfonic acid is O=c1[nH]c2ccc(S(=O)(=O)O)cc2s1.
What is the InChIKey of 2-oxo-3H-1,3-benzothiazole-6-sulfonic acid?
The InChIKey is ZSPDJLKUEUXBSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO4S2/c9-7-8-5-2-1-4(14(10,11)12)3-6(5)13-7/h1-3H,(H,8,9)(H,10,11,12).
What are the key properties of 2-oxo-3H-1,3-benzothiazole-6-sulfonic acid?
2-oxo-3H-1,3-benzothiazole-6-sulfonic acid has a molecular weight of 231.25 g/mol, XLogP of 0.84, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-3H-1,3-benzothiazole-6-sulfonic acid is sourced from PubChem (CID 3149144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).