About 4-ethoxy-1,3-dimethyl-2-pentylcyclohepta[c]pyrrol-8-one
4-ethoxy-1,3-dimethyl-2-pentylcyclohepta[c]pyrrol-8-one (PubChem CID 3149364) has the molecular formula C18H25NO2
and a molecular weight of 287.40 g/mol. Its IUPAC name is 4-ethoxy-1,3-dimethyl-2-pentylcyclohepta[c]pyrrol-8-one.
Molecular Properties
| Compound Name | 4-ethoxy-1,3-dimethyl-2-pentylcyclohepta[c]pyrrol-8-one |
| PubChem CID | 3149364 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 4-ethoxy-1,3-dimethyl-2-pentylcyclohepta[c]pyrrol-8-one |
| SMILES | CCCCCn1c(C)c2c(OCC)cccc(=O)c2c1C |
| InChI | InChI=1S/C18H25NO2/c1-5-7-8-12-19-13(3)17-15(20)10-9-11-16(21-6-2)18(17)14(19)4/h9-11H,5-8,12H2,1-4H3 |
| InChIKey | SDWPXJUXCLOURP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxy-1,3-dimethyl-2-pentylcyclohepta[c]pyrrol-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-1,3-dimethyl-2-pentylcyclohepta[c]pyrrol-8-one?
The IUPAC name of 4-ethoxy-1,3-dimethyl-2-pentylcyclohepta[c]pyrrol-8-one (CID 3149364) is 4-ethoxy-1,3-dimethyl-2-pentylcyclohepta[c]pyrrol-8-one.
What is the SMILES notation for 4-ethoxy-1,3-dimethyl-2-pentylcyclohepta[c]pyrrol-8-one?
The canonical SMILES for 4-ethoxy-1,3-dimethyl-2-pentylcyclohepta[c]pyrrol-8-one is CCCCCn1c(C)c2c(OCC)cccc(=O)c2c1C.
What is the InChIKey of 4-ethoxy-1,3-dimethyl-2-pentylcyclohepta[c]pyrrol-8-one?
The InChIKey is SDWPXJUXCLOURP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO2/c1-5-7-8-12-19-13(3)17-15(20)10-9-11-16(21-6-2)18(17)14(19)4/h9-11H,5-8,12H2,1-4H3.
What are the key properties of 4-ethoxy-1,3-dimethyl-2-pentylcyclohepta[c]pyrrol-8-one?
4-ethoxy-1,3-dimethyl-2-pentylcyclohepta[c]pyrrol-8-one has a molecular weight of 287.40 g/mol, XLogP of 4.21, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-1,3-dimethyl-2-pentylcyclohepta[c]pyrrol-8-one is sourced from PubChem (CID 3149364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).