About 1-(2,1,3-benzothiadiazol-5-yl)-3-(2-hydroxyethyl)urea
1-(2,1,3-benzothiadiazol-5-yl)-3-(2-hydroxyethyl)urea (PubChem CID 3149528) has the molecular formula C9H10N4O2S
and a molecular weight of 238.27 g/mol. Its IUPAC name is 1-(2,1,3-benzothiadiazol-5-yl)-3-(2-hydroxyethyl)urea.
Molecular Properties
| Compound Name | 1-(2,1,3-benzothiadiazol-5-yl)-3-(2-hydroxyethyl)urea |
| PubChem CID | 3149528 |
| Molecular Formula | C9H10N4O2S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 1-(2,1,3-benzothiadiazol-5-yl)-3-(2-hydroxyethyl)urea |
| SMILES | O=C(NCCO)Nc1ccc2nsnc2c1 |
| InChI | InChI=1S/C9H10N4O2S/c14-4-3-10-9(15)11-6-1-2-7-8(5-6)13-16-12-7/h1-2,5,14H,3-4H2,(H2,10,11,15) |
| InChIKey | DYSHTSRUGBHSRK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2,1,3-benzothiadiazol-5-yl)-3-(2-hydroxyethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,1,3-benzothiadiazol-5-yl)-3-(2-hydroxyethyl)urea?
The IUPAC name of 1-(2,1,3-benzothiadiazol-5-yl)-3-(2-hydroxyethyl)urea (CID 3149528) is 1-(2,1,3-benzothiadiazol-5-yl)-3-(2-hydroxyethyl)urea.
What is the SMILES notation for 1-(2,1,3-benzothiadiazol-5-yl)-3-(2-hydroxyethyl)urea?
The canonical SMILES for 1-(2,1,3-benzothiadiazol-5-yl)-3-(2-hydroxyethyl)urea is O=C(NCCO)Nc1ccc2nsnc2c1.
What is the InChIKey of 1-(2,1,3-benzothiadiazol-5-yl)-3-(2-hydroxyethyl)urea?
The InChIKey is DYSHTSRUGBHSRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2S/c14-4-3-10-9(15)11-6-1-2-7-8(5-6)13-16-12-7/h1-2,5,14H,3-4H2,(H2,10,11,15).
What are the key properties of 1-(2,1,3-benzothiadiazol-5-yl)-3-(2-hydroxyethyl)urea?
1-(2,1,3-benzothiadiazol-5-yl)-3-(2-hydroxyethyl)urea has a molecular weight of 238.27 g/mol, XLogP of 0.81, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,1,3-benzothiadiazol-5-yl)-3-(2-hydroxyethyl)urea is sourced from PubChem (CID 3149528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).