About N-propyl-1,2,3-benzothiadiazole-5-carboxamide
N-propyl-1,2,3-benzothiadiazole-5-carboxamide (PubChem CID 3149533) has the molecular formula C10H11N3OS
and a molecular weight of 221.29 g/mol. Its IUPAC name is N-propyl-1,2,3-benzothiadiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-propyl-1,2,3-benzothiadiazole-5-carboxamide |
| PubChem CID | 3149533 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | N-propyl-1,2,3-benzothiadiazole-5-carboxamide |
| SMILES | CCCNC(=O)c1ccc2snnc2c1 |
| InChI | InChI=1S/C10H11N3OS/c1-2-5-11-10(14)7-3-4-9-8(6-7)12-13-15-9/h3-4,6H,2,5H2,1H3,(H,11,14) |
| InChIKey | VPDGEUJRACYZJC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-propyl-1,2,3-benzothiadiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propyl-1,2,3-benzothiadiazole-5-carboxamide?
The IUPAC name of N-propyl-1,2,3-benzothiadiazole-5-carboxamide (CID 3149533) is N-propyl-1,2,3-benzothiadiazole-5-carboxamide.
What is the SMILES notation for N-propyl-1,2,3-benzothiadiazole-5-carboxamide?
The canonical SMILES for N-propyl-1,2,3-benzothiadiazole-5-carboxamide is CCCNC(=O)c1ccc2snnc2c1.
What is the InChIKey of N-propyl-1,2,3-benzothiadiazole-5-carboxamide?
The InChIKey is VPDGEUJRACYZJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3OS/c1-2-5-11-10(14)7-3-4-9-8(6-7)12-13-15-9/h3-4,6H,2,5H2,1H3,(H,11,14).
What are the key properties of N-propyl-1,2,3-benzothiadiazole-5-carboxamide?
N-propyl-1,2,3-benzothiadiazole-5-carboxamide has a molecular weight of 221.29 g/mol, XLogP of 1.83, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-propyl-1,2,3-benzothiadiazole-5-carboxamide is sourced from PubChem (CID 3149533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).