About 2-[2-(3,4-dimethylphenoxy)ethylsulfanyl]-5-(2-ethoxyethyl)-4-hydroxy-1H-pyrimidin-6-one
2-[2-(3,4-dimethylphenoxy)ethylsulfanyl]-5-(2-ethoxyethyl)-4-hydroxy-1H-pyrimidin-6-one (PubChem CID 3149890) has the molecular formula C18H24N2O4S
and a molecular weight of 364.47 g/mol. Its IUPAC name is 2-[2-(3,4-dimethylphenoxy)ethylsulfanyl]-5-(2-ethoxyethyl)-4-hydroxy-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-[2-(3,4-dimethylphenoxy)ethylsulfanyl]-5-(2-ethoxyethyl)-4-hydroxy-1H-pyrimidin-6-one |
| PubChem CID | 3149890 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-[2-(3,4-dimethylphenoxy)ethylsulfanyl]-5-(2-ethoxyethyl)-4-hydroxy-1H-pyrimidin-6-one |
| SMILES | CCOCCc1c(O)nc(SCCOc2ccc(C)c(C)c2)[nH]c1=O |
| InChI | InChI=1S/C18H24N2O4S/c1-4-23-8-7-15-16(21)19-18(20-17(15)22)25-10-9-24-14-6-5-12(2)13(3)11-14/h5-6,11H,4,7-10H2,1-3H3,(H2,19,20,21,22) |
| InChIKey | IYLPPPMPJSXREY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(3,4-dimethylphenoxy)ethylsulfanyl]-5-(2-ethoxyethyl)-4-hydroxy-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,4-dimethylphenoxy)ethylsulfanyl]-5-(2-ethoxyethyl)-4-hydroxy-1H-pyrimidin-6-one?
The IUPAC name of 2-[2-(3,4-dimethylphenoxy)ethylsulfanyl]-5-(2-ethoxyethyl)-4-hydroxy-1H-pyrimidin-6-one (CID 3149890) is 2-[2-(3,4-dimethylphenoxy)ethylsulfanyl]-5-(2-ethoxyethyl)-4-hydroxy-1H-pyrimidin-6-one.
What is the SMILES notation for 2-[2-(3,4-dimethylphenoxy)ethylsulfanyl]-5-(2-ethoxyethyl)-4-hydroxy-1H-pyrimidin-6-one?
The canonical SMILES for 2-[2-(3,4-dimethylphenoxy)ethylsulfanyl]-5-(2-ethoxyethyl)-4-hydroxy-1H-pyrimidin-6-one is CCOCCc1c(O)nc(SCCOc2ccc(C)c(C)c2)[nH]c1=O.
What is the InChIKey of 2-[2-(3,4-dimethylphenoxy)ethylsulfanyl]-5-(2-ethoxyethyl)-4-hydroxy-1H-pyrimidin-6-one?
The InChIKey is IYLPPPMPJSXREY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O4S/c1-4-23-8-7-15-16(21)19-18(20-17(15)22)25-10-9-24-14-6-5-12(2)13(3)11-14/h5-6,11H,4,7-10H2,1-3H3,(H2,19,20,21,22).
What are the key properties of 2-[2-(3,4-dimethylphenoxy)ethylsulfanyl]-5-(2-ethoxyethyl)-4-hydroxy-1H-pyrimidin-6-one?
2-[2-(3,4-dimethylphenoxy)ethylsulfanyl]-5-(2-ethoxyethyl)-4-hydroxy-1H-pyrimidin-6-one has a molecular weight of 364.47 g/mol, XLogP of 2.84, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,4-dimethylphenoxy)ethylsulfanyl]-5-(2-ethoxyethyl)-4-hydroxy-1H-pyrimidin-6-one is sourced from PubChem (CID 3149890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).