C23H33N7O — CID 3149930
3-[(1-tert-butyltetrazol-5-yl)-(4-propylpiperazin-1-yl)methyl]-6-methyl-1H-quinolin-2-one (PubChem CID 3149930) has the molecular formula C23H33N7O and a molecular weight of 423.57 g/mol. Its IUPAC name is 3-[(1-tert-butyltetrazol-5-yl)-(4-propylpiperazin-1-yl)methyl]-6-methyl-1H-quinolin-2-one.
| Compound Name | 3-[(1-tert-butyltetrazol-5-yl)-(4-propylpiperazin-1-yl)methyl]-6-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 3149930 |
| Molecular Formula | C23H33N7O |
| Molecular Weight | 423.57 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | 3-[(1-tert-butyltetrazol-5-yl)-(4-propylpiperazin-1-yl)methyl]-6-methyl-1H-quinolin-2-one |
| SMILES | CCCN1CCN(C(c2cc3cc(C)ccc3[nH]c2=O)c2nnnn2C(C)(C)C)CC1 |
| InChI | InChI=1S/C23H33N7O/c1-6-9-28-10-12-29(13-11-28)20(21-25-26-27-30(21)23(3,4)5)18-15-17-14-16(2)7-8-19(17)24-22(18)31/h7-8,14-15,20H,6,9-13H2,1-5H3,(H,24,31) |
| InChIKey | XEBZCRBWCRMRAG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.57 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |