C23H32N6O2 — CID 3150414
3-[(1-tert-butyltetrazol-5-yl)-(4-methylpiperidin-1-yl)methyl]-6-ethoxy-1H-quinolin-2-one (PubChem CID 3150414) has the molecular formula C23H32N6O2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 3-[(1-tert-butyltetrazol-5-yl)-(4-methylpiperidin-1-yl)methyl]-6-ethoxy-1H-quinolin-2-one.
| Compound Name | 3-[(1-tert-butyltetrazol-5-yl)-(4-methylpiperidin-1-yl)methyl]-6-ethoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 3150414 |
| Molecular Formula | C23H32N6O2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 3-[(1-tert-butyltetrazol-5-yl)-(4-methylpiperidin-1-yl)methyl]-6-ethoxy-1H-quinolin-2-one |
| SMILES | CCOc1ccc2[nH]c(=O)c(C(c3nnnn3C(C)(C)C)N3CCC(C)CC3)cc2c1 |
| InChI | InChI=1S/C23H32N6O2/c1-6-31-17-7-8-19-16(13-17)14-18(22(30)24-19)20(28-11-9-15(2)10-12-28)21-25-26-27-29(21)23(3,4)5/h7-8,13-15,20H,6,9-12H2,1-5H3,(H,24,30) |
| InChIKey | ZORMNJNUCSNEBZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 88.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |