C18H18FNO2S — CID 31504901
2-(4-acetyl-2-fluorophenyl)sulfanyl-N-[(4-methylphenyl)methyl]acetamide (PubChem CID 31504901) has the molecular formula C18H18FNO2S and a molecular weight of 331.41 g/mol. Its IUPAC name is 2-(4-acetyl-2-fluorophenyl)sulfanyl-N-[(4-methylphenyl)methyl]acetamide.
| Compound Name | 2-(4-acetyl-2-fluorophenyl)sulfanyl-N-[(4-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 31504901 |
| Molecular Formula | C18H18FNO2S |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 2-(4-acetyl-2-fluorophenyl)sulfanyl-N-[(4-methylphenyl)methyl]acetamide |
| SMILES | CC(=O)c1ccc(SCC(=O)NCc2ccc(C)cc2)c(F)c1 |
| InChI | InChI=1S/C18H18FNO2S/c1-12-3-5-14(6-4-12)10-20-18(22)11-23-17-8-7-15(13(2)21)9-16(17)19/h3-9H,10-11H2,1-2H3,(H,20,22) |
| InChIKey | GDTZKZIBUKKRBD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |