About N-(furan-2-ylmethyl)-1,2-diphenylethanamine
N-(furan-2-ylmethyl)-1,2-diphenylethanamine (PubChem CID 3150631) has the molecular formula C19H19NO
and a molecular weight of 277.37 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1,2-diphenylethanamine.
Molecular Properties
| Compound Name | N-(furan-2-ylmethyl)-1,2-diphenylethanamine |
| PubChem CID | 3150631 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | N-(furan-2-ylmethyl)-1,2-diphenylethanamine |
| SMILES | c1ccc(CC(NCc2ccco2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H19NO/c1-3-8-16(9-4-1)14-19(17-10-5-2-6-11-17)20-15-18-12-7-13-21-18/h1-13,19-20H,14-15H2 |
| InChIKey | VMNIIKOXLGLGFQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(furan-2-ylmethyl)-1,2-diphenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(furan-2-ylmethyl)-1,2-diphenylethanamine?
The IUPAC name of N-(furan-2-ylmethyl)-1,2-diphenylethanamine (CID 3150631) is N-(furan-2-ylmethyl)-1,2-diphenylethanamine.
What is the SMILES notation for N-(furan-2-ylmethyl)-1,2-diphenylethanamine?
The canonical SMILES for N-(furan-2-ylmethyl)-1,2-diphenylethanamine is c1ccc(CC(NCc2ccco2)c2ccccc2)cc1.
What is the InChIKey of N-(furan-2-ylmethyl)-1,2-diphenylethanamine?
The InChIKey is VMNIIKOXLGLGFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO/c1-3-8-16(9-4-1)14-19(17-10-5-2-6-11-17)20-15-18-12-7-13-21-18/h1-13,19-20H,14-15H2.
What are the key properties of N-(furan-2-ylmethyl)-1,2-diphenylethanamine?
N-(furan-2-ylmethyl)-1,2-diphenylethanamine has a molecular weight of 277.37 g/mol, XLogP of 4.35, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(furan-2-ylmethyl)-1,2-diphenylethanamine is sourced from PubChem (CID 3150631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).