C16H12N6O3 — CID 31508079
7-methyl-N-(2-methyl-1,3-dioxoisoindol-5-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 31508079) has the molecular formula C16H12N6O3 and a molecular weight of 336.31 g/mol. Its IUPAC name is 7-methyl-N-(2-methyl-1,3-dioxoisoindol-5-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 7-methyl-N-(2-methyl-1,3-dioxoisoindol-5-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 31508079 |
| Molecular Formula | C16H12N6O3 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 7-methyl-N-(2-methyl-1,3-dioxoisoindol-5-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | Cc1ccnc2nc(C(=O)Nc3ccc4c(c3)C(=O)N(C)C4=O)nn12 |
| InChI | InChI=1S/C16H12N6O3/c1-8-5-6-17-16-19-12(20-22(8)16)13(23)18-9-3-4-10-11(7-9)15(25)21(2)14(10)24/h3-7H,1-2H3,(H,18,23) |
| InChIKey | APXUEOVJWDFAGJ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|