About 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)acetamide
2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)acetamide (PubChem CID 3150928) has the molecular formula C8H10FN3O4
and a molecular weight of 231.18 g/mol. Its IUPAC name is 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)acetamide.
Molecular Properties
| Compound Name | 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)acetamide |
| PubChem CID | 3150928 |
| Molecular Formula | C8H10FN3O4 |
| Molecular Weight | 231.18 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)acetamide |
| SMILES | O=C(Cn1cc(F)c(=O)[nH]c1=O)NCCO |
| InChI | InChI=1S/C8H10FN3O4/c9-5-3-12(8(16)11-7(5)15)4-6(14)10-1-2-13/h3,13H,1-2,4H2,(H,10,14)(H,11,15,16) |
| InChIKey | MKOQJGORIPDFNY-UHFFFAOYSA-N |
| XLogP | -2.22 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.18 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)acetamide?
The IUPAC name of 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)acetamide (CID 3150928) is 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)acetamide.
What is the SMILES notation for 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)acetamide?
The canonical SMILES for 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)acetamide is O=C(Cn1cc(F)c(=O)[nH]c1=O)NCCO.
What is the InChIKey of 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)acetamide?
The InChIKey is MKOQJGORIPDFNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FN3O4/c9-5-3-12(8(16)11-7(5)15)4-6(14)10-1-2-13/h3,13H,1-2,4H2,(H,10,14)(H,11,15,16).
What are the key properties of 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)acetamide?
2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)acetamide has a molecular weight of 231.18 g/mol, XLogP of -2.22, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-N-(2-hydroxyethyl)acetamide is sourced from PubChem (CID 3150928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).